About (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride
(3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride (PubChem CID 163323645) has the molecular formula C15H22ClNO2
and a molecular weight of 283.80 g/mol. Its IUPAC name is (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride.
Molecular Properties
| Compound Name | (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride |
| PubChem CID | 163323645 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride |
| SMILES | CC(C)C[C@]1(C)N[C@@H](c2ccccc2)COC1=O.Cl |
| InChI | InChI=1S/C15H21NO2.ClH/c1-11(2)9-15(3)14(17)18-10-13(16-15)12-7-5-4-6-8-12;/h4-8,11,13,16H,9-10H2,1-3H3;1H/t13-,15+;/m1./s1 |
| InChIKey | PXDXRHITAUWESK-PBCQUBLHSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride?
The IUPAC name of (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride (CID 163323645) is (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride.
What is the SMILES notation for (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride?
The canonical SMILES for (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride is CC(C)C[C@]1(C)N[C@@H](c2ccccc2)COC1=O.Cl.
What is the InChIKey of (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride?
The InChIKey is PXDXRHITAUWESK-PBCQUBLHSA-N. The full InChI is InChI=1S/C15H21NO2.ClH/c1-11(2)9-15(3)14(17)18-10-13(16-15)12-7-5-4-6-8-12;/h4-8,11,13,16H,9-10H2,1-3H3;1H/t13-,15+;/m1./s1.
What are the key properties of (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride?
(3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride has a molecular weight of 283.80 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3-methyl-3-(2-methylpropyl)-5-phenylmorpholin-2-one;hydrochloride is sourced from PubChem (CID 163323645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).