C31H34N6O3 — CID 163323742
1-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-[2-(3,4-dihydroxyphenyl)ethyl]urea (PubChem CID 163323742) has the molecular formula C31H34N6O3 and a molecular weight of 538.65 g/mol. Its IUPAC name is 1-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-[2-(3,4-dihydroxyphenyl)ethyl]urea.
| Compound Name | 1-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-[2-(3,4-dihydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 163323742 |
| Molecular Formula | C31H34N6O3 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 1-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-[2-(3,4-dihydroxyphenyl)ethyl]urea |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc(CNC(=O)NCCc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C31H34N6O3/c1-2-3-8-27-36-28-29(23-6-4-5-7-24(23)35-30(28)32)37(27)19-22-11-9-21(10-12-22)18-34-31(40)33-16-15-20-13-14-25(38)26(39)17-20/h4-7,9-14,17,38-39H,2-3,8,15-16,18-19H2,1H3,(H2,32,35)(H2,33,34,40) |
| InChIKey | XIUYQOKKDQPUCV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|