C30H62O5Si3 — CID 163323877
[(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-7-methylidenecyclohepten-1-yl]methanol (PubChem CID 163323877) has the molecular formula C30H62O5Si3 and a molecular weight of 587.08 g/mol. Its IUPAC name is [(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-7-methylidenecyclohepten-1-yl]methanol.
| Compound Name | [(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-7-methylidenecyclohepten-1-yl]methanol |
|---|---|
| PubChem CID | 163323877 |
| Molecular Formula | C30H62O5Si3 |
| Molecular Weight | 587.08 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | [(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-7-methylidenecyclohepten-1-yl]methanol |
| SMILES | C=C1C(CO)=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCCCO[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H62O5Si3/c1-23-24(22-31)18-19-25(34-37(13,14)29(5,6)7)27(26(23)35-38(15,16)30(8,9)10)32-20-17-21-33-36(11,12)28(2,3)4/h18,25-27,31H,1,17,19-22H2,2-16H3/t25-,26-,27-/m1/s1 |
| InChIKey | KRABPXIKVIIGHO-ZONZVBGPSA-N |
| XLogP | 8.44 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.08 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|