C5H8F5NO5S2 — CID 163323932
3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propane-1-sulfonic acid (PubChem CID 163323932) has the molecular formula C5H8F5NO5S2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propane-1-sulfonic acid.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 163323932 |
| Molecular Formula | C5H8F5NO5S2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H8F5NO5S2/c6-4(7,8)5(9,10)18(15,16)11-2-1-3-17(12,13)14/h11H,1-3H2,(H,12,13,14) |
| InChIKey | RNRXXRAIQNUKCT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|