C11H5F19O4S — CID 163324019
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoro-1-hydroxyundecane-1-sulfonic acid (PubChem CID 163324019) has the molecular formula C11H5F19O4S and a molecular weight of 594.19 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoro-1-hydroxyundecane-1-sulfonic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoro-1-hydroxyundecane-1-sulfonic acid |
|---|---|
| PubChem CID | 163324019 |
| Molecular Formula | C11H5F19O4S |
| Molecular Weight | 594.19 g/mol |
| Exact Mass | 593.96 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoro-1-hydroxyundecane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F19O4S/c12-3(13,1-2(31)35(32,33)34)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)30/h2,31H,1H2,(H,32,33,34) |
| InChIKey | QHPUGDMKHLYWBL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.19 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|