C7H9F5O4S — CID 163324026
3-(3,3,4,4,4-pentafluorobutylsulfonyl)propanoic acid (PubChem CID 163324026) has the molecular formula C7H9F5O4S and a molecular weight of 284.20 g/mol. Its IUPAC name is 3-(3,3,4,4,4-pentafluorobutylsulfonyl)propanoic acid.
| Compound Name | 3-(3,3,4,4,4-pentafluorobutylsulfonyl)propanoic acid |
|---|---|
| PubChem CID | 163324026 |
| Molecular Formula | C7H9F5O4S |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 3-(3,3,4,4,4-pentafluorobutylsulfonyl)propanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9F5O4S/c8-6(9,7(10,11)12)2-4-17(15,16)3-1-5(13)14/h1-4H2,(H,13,14) |
| InChIKey | DYLSUONSWDIYHQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|