C11H22F5N2O5S+ — CID 163324035
2,3-dihydroxypropyl-[4-hydroxy-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)butyl]-dimethylazanium (PubChem CID 163324035) has the molecular formula C11H22F5N2O5S+ and a molecular weight of 389.36 g/mol. Its IUPAC name is 2,3-dihydroxypropyl-[4-hydroxy-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)butyl]-dimethylazanium.
| Compound Name | 2,3-dihydroxypropyl-[4-hydroxy-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)butyl]-dimethylazanium |
|---|---|
| PubChem CID | 163324035 |
| Molecular Formula | C11H22F5N2O5S+ |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2,3-dihydroxypropyl-[4-hydroxy-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)butyl]-dimethylazanium |
| SMILES | C[N+](C)(CCC(CO)NS(=O)(=O)C(F)(F)C(F)(F)F)CC(O)CO |
| InChI | InChI=1S/C11H22F5N2O5S/c1-18(2,5-9(21)7-20)4-3-8(6-19)17-24(22,23)11(15,16)10(12,13)14/h8-9,17,19-21H,3-7H2,1-2H3/q+1 |
| InChIKey | LDZIFNIHIQHLRV-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|