C7H13F5N2O2S — CID 163324129
N-[3-(dimethylamino)propyl]-1,1,2,2,2-pentafluoroethanesulfonamide (PubChem CID 163324129) has the molecular formula C7H13F5N2O2S and a molecular weight of 284.25 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1,1,2,2,2-pentafluoroethanesulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1,1,2,2,2-pentafluoroethanesulfonamide |
|---|---|
| PubChem CID | 163324129 |
| Molecular Formula | C7H13F5N2O2S |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1,1,2,2,2-pentafluoroethanesulfonamide |
| SMILES | CN(C)CCCNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H13F5N2O2S/c1-14(2)5-3-4-13-17(15,16)7(11,12)6(8,9)10/h13H,3-5H2,1-2H3 |
| InChIKey | NUDDWLRMCQRPJR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|