C10H4F19NO2S — CID 163324216
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluoro-N-methylnonane-1-sulfonamide (PubChem CID 163324216) has the molecular formula C10H4F19NO2S and a molecular weight of 563.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluoro-N-methylnonane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluoro-N-methylnonane-1-sulfonamide |
|---|---|
| PubChem CID | 163324216 |
| Molecular Formula | C10H4F19NO2S |
| Molecular Weight | 563.18 g/mol |
| Exact Mass | 562.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluoro-N-methylnonane-1-sulfonamide |
| SMILES | CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4F19NO2S/c1-30-33(31,32)10(28,29)8(23,24)6(19,20)4(15,16)2(11,12)3(13,14)5(17,18)7(21,22)9(25,26)27/h30H,1H3 |
| InChIKey | HJFPHSXVPLEBIW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.18 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|