C12H4F23NO2S — CID 163324217
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoro-N-methylundecane-1-sulfonamide (PubChem CID 163324217) has the molecular formula C12H4F23NO2S and a molecular weight of 663.19 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoro-N-methylundecane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoro-N-methylundecane-1-sulfonamide |
|---|---|
| PubChem CID | 163324217 |
| Molecular Formula | C12H4F23NO2S |
| Molecular Weight | 663.19 g/mol |
| Exact Mass | 662.96 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-tricosafluoro-N-methylundecane-1-sulfonamide |
| SMILES | CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4F23NO2S/c1-36-39(37,38)12(34,35)10(29,30)8(25,26)6(21,22)4(17,18)2(13,14)3(15,16)5(19,20)7(23,24)9(27,28)11(31,32)33/h36H,1H3 |
| InChIKey | XTYJZYCWZAWPFL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.19 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|