C29H36N4O6 — CID 163326811
N-[3-(diethylamino)propyl]-2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide;oxalic acid (PubChem CID 163326811) has the molecular formula C29H36N4O6 and a molecular weight of 536.63 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide;oxalic acid.
| Compound Name | N-[3-(diethylamino)propyl]-2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 163326811 |
| Molecular Formula | C29H36N4O6 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide;oxalic acid |
| SMILES | CCN(CC)CCCNC(=O)CN1C(=O)c2ccccc2C1c1c(C)n(C)c2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H34N4O2.C2H2O4/c1-5-30(6-2)17-11-16-28-24(32)18-31-26(20-12-7-8-13-21(20)27(31)33)25-19(3)29(4)23-15-10-9-14-22(23)25;3-1(4)2(5)6/h7-10,12-15,26H,5-6,11,16-18H2,1-4H3,(H,28,32);(H,3,4)(H,5,6) |
| InChIKey | ITBJXAPTMBNCFY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|