C19H24N2O6 — CID 163327128
N-[(2,3-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)ethanamine;oxalic acid (PubChem CID 163327128) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)ethanamine;oxalic acid.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 163327128 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-N-(pyridin-4-ylmethyl)ethanamine;oxalic acid |
| SMILES | CCN(Cc1ccncc1)Cc1cccc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H22N2O2.C2H2O4/c1-4-19(12-14-8-10-18-11-9-14)13-15-6-5-7-16(20-2)17(15)21-3;3-1(4)2(5)6/h5-11H,4,12-13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SABPHOJJFQJJMN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|