C15H21NO4 — CID 163327213
N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid (PubChem CID 163327213) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid.
| Compound Name | N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid |
|---|---|
| PubChem CID | 163327213 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid |
| SMILES | Cc1cccc(CNC2CCCC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H19N.C2H2O4/c1-11-5-4-6-12(9-11)10-14-13-7-2-3-8-13;3-1(4)2(5)6/h4-6,9,13-14H,2-3,7-8,10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | RPXTXWMNDYNZSA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|