N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid

C15H21NO4 — CID 163327213

IUPACN-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid
SMILESCc1cccc(CNC2CCCC2)c1.O=C(O)C(=O)O
InChIInChI=1S/C13H19N.C2H2O4/c1-11-5-4-6-12(9-11)10-14-13-7-2-3-8-13;3-1(4)2(5)6/h4-6,9,13-14H,2-3,7-8,10H2,1H3;(H,3,4)(H,5,6)
InChIKeyRPXTXWMNDYNZSA-UHFFFAOYSA-N
MW279.34 g/mol
LogP2.18
Rot. Bonds3

About N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid

N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid (PubChem CID 163327213) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid.

Molecular Properties

Compound NameN-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid
PubChem CID163327213
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC NameN-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid
SMILESCc1cccc(CNC2CCCC2)c1.O=C(O)C(=O)O
InChIInChI=1S/C13H19N.C2H2O4/c1-11-5-4-6-12(9-11)10-14-13-7-2-3-8-13;3-1(4)2(5)6/h4-6,9,13-14H,2-3,7-8,10H2,1H3;(H,3,4)(H,5,6)
InChIKeyRPXTXWMNDYNZSA-UHFFFAOYSA-N
XLogP2.18
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 52.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid?
The IUPAC name of N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid (CID 163327213) is N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid.
What is the SMILES notation for N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid?
The canonical SMILES for N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid is Cc1cccc(CNC2CCCC2)c1.O=C(O)C(=O)O.
What is the InChIKey of N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid?
The InChIKey is RPXTXWMNDYNZSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N.C2H2O4/c1-11-5-4-6-12(9-11)10-14-13-7-2-3-8-13;3-1(4)2(5)6/h4-6,9,13-14H,2-3,7-8,10H2,1H3;(H,3,4)(H,5,6).
What are the key properties of N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid?
N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid has a molecular weight of 279.34 g/mol, XLogP of 2.18, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methylphenyl)methyl]cyclopentanamine;oxalic acid is sourced from PubChem (CID 163327213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).