C15H20FNO4 — CID 163328098
1-[(2-fluorophenyl)methyl]azepane;oxalic acid (PubChem CID 163328098) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]azepane;oxalic acid.
| Compound Name | 1-[(2-fluorophenyl)methyl]azepane;oxalic acid |
|---|---|
| PubChem CID | 163328098 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]azepane;oxalic acid |
| SMILES | Fc1ccccc1CN1CCCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H18FN.C2H2O4/c14-13-8-4-3-7-12(13)11-15-9-5-1-2-6-10-15;3-1(4)2(5)6/h3-4,7-8H,1-2,5-6,9-11H2;(H,3,4)(H,5,6) |
| InChIKey | DXJXZAHMDZYLHC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|