About 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide
1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide (PubChem CID 163329419) has the molecular formula C15H14BrCl2N3
and a molecular weight of 387.11 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide.
Molecular Properties
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide |
| PubChem CID | 163329419 |
| Molecular Formula | C15H14BrCl2N3 |
| Molecular Weight | 387.11 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide |
| SMILES | Br.[H]/N=c1\n(C)c2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3.BrH/c1-19-13-4-2-3-5-14(13)20(15(19)18)9-10-6-7-11(16)12(17)8-10;/h2-8,18H,9H2,1H3;1H/b18-15+; |
| InChIKey | ZYXDCWRDQMIFAC-FLNCGGNMSA-N |
| XLogP | 4.39 |
| TPSA | 33.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.11 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide?
The IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide (CID 163329419) is 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide.
What is the SMILES notation for 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide?
The canonical SMILES for 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide is Br.[H]/N=c1\n(C)c2ccccc2n1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide?
The InChIKey is ZYXDCWRDQMIFAC-FLNCGGNMSA-N. The full InChI is InChI=1S/C15H13Cl2N3.BrH/c1-19-13-4-2-3-5-14(13)20(15(19)18)9-10-6-7-11(16)12(17)8-10;/h2-8,18H,9H2,1H3;1H/b18-15+;.
What are the key properties of 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide?
1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide has a molecular weight of 387.11 g/mol, XLogP of 4.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dichlorophenyl)methyl]-3-methylbenzimidazol-2-imine;hydrobromide is sourced from PubChem (CID 163329419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).