C28H29Cl3N10S2 — CID 163329748
bis(4-(3-chlorophenyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione);hydrochloride (PubChem CID 163329748) has the molecular formula C28H29Cl3N10S2 and a molecular weight of 676.10 g/mol. Its IUPAC name is bis(4-(3-chlorophenyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione);hydrochloride.
| Compound Name | bis(4-(3-chlorophenyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione);hydrochloride |
|---|---|
| PubChem CID | 163329748 |
| Molecular Formula | C28H29Cl3N10S2 |
| Molecular Weight | 676.10 g/mol |
| Exact Mass | 674.11 |
| IUPAC Name | bis(4-(3-chlorophenyl)-3-[2-(4-methylpyrazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione);hydrochloride |
| SMILES | Cc1cnn(CCc2n[nH]c(=S)n2-c2cccc(Cl)c2)c1.Cc1cnn(CCc2n[nH]c(=S)n2-c2cccc(Cl)c2)c1.Cl |
| InChI | InChI=1S/2C14H14ClN5S.ClH/c2*1-10-8-16-19(9-10)6-5-13-17-18-14(21)20(13)12-4-2-3-11(15)7-12;/h2*2-4,7-9H,5-6H2,1H3,(H,18,21);1H |
| InChIKey | HASIIBNYTLDTHX-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.10 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|