C13H22ClN3O2 — CID 163329753
4-(3-methylbutyl)-2-morpholin-4-yl-1H-pyrimidin-6-one;hydrochloride (PubChem CID 163329753) has the molecular formula C13H22ClN3O2 and a molecular weight of 287.79 g/mol. Its IUPAC name is 4-(3-methylbutyl)-2-morpholin-4-yl-1H-pyrimidin-6-one;hydrochloride.
| Compound Name | 4-(3-methylbutyl)-2-morpholin-4-yl-1H-pyrimidin-6-one;hydrochloride |
|---|---|
| PubChem CID | 163329753 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-(3-methylbutyl)-2-morpholin-4-yl-1H-pyrimidin-6-one;hydrochloride |
| SMILES | CC(C)CCc1cc(=O)[nH]c(N2CCOCC2)n1.Cl |
| InChI | InChI=1S/C13H21N3O2.ClH/c1-10(2)3-4-11-9-12(17)15-13(14-11)16-5-7-18-8-6-16;/h9-10H,3-8H2,1-2H3,(H,14,15,17);1H |
| InChIKey | LUPAOGLXNJGVPU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |