C18H18ClN3OS — CID 163330053
4-(1H-benzimidazol-2-yl)-1-(3-methylsulfanylphenyl)pyrrolidin-2-one;hydrochloride (PubChem CID 163330053) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1-(3-methylsulfanylphenyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 4-(1H-benzimidazol-2-yl)-1-(3-methylsulfanylphenyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 163330053 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1-(3-methylsulfanylphenyl)pyrrolidin-2-one;hydrochloride |
| SMILES | CSc1cccc(N2CC(c3nc4ccccc4[nH]3)CC2=O)c1.Cl |
| InChI | InChI=1S/C18H17N3OS.ClH/c1-23-14-6-4-5-13(10-14)21-11-12(9-17(21)22)18-19-15-7-2-3-8-16(15)20-18;/h2-8,10,12H,9,11H2,1H3,(H,19,20);1H |
| InChIKey | KUYUPEOQGLXPBZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |