C43H41N7O11S2 — CID 163330287
N,N-dimethylformamide;bis(N-(furan-2-ylmethyl)-2-[(4-nitrobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide) (PubChem CID 163330287) has the molecular formula C43H41N7O11S2 and a molecular weight of 895.97 g/mol. Its IUPAC name is N,N-dimethylformamide;bis(N-(furan-2-ylmethyl)-2-[(4-nitrobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide).
| Compound Name | N,N-dimethylformamide;bis(N-(furan-2-ylmethyl)-2-[(4-nitrobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide) |
|---|---|
| PubChem CID | 163330287 |
| Molecular Formula | C43H41N7O11S2 |
| Molecular Weight | 895.97 g/mol |
| Exact Mass | 895.23 |
| IUPAC Name | N,N-dimethylformamide;bis(N-(furan-2-ylmethyl)-2-[(4-nitrobenzoyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide) |
| SMILES | CN(C)C=O.O=C(Nc1sc2c(c1C(=O)NCc1ccco1)CCC2)c1ccc([N+](=O)[O-])cc1.O=C(Nc1sc2c(c1C(=O)NCc1ccco1)CCC2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C20H17N3O5S.C3H7NO/c2*24-18(12-6-8-13(9-7-12)23(26)27)22-20-17(15-4-1-5-16(15)29-20)19(25)21-11-14-3-2-10-28-14;1-4(2)3-5/h2*2-3,6-10H,1,4-5,11H2,(H,21,25)(H,22,24);3H,1-2H3 |
| InChIKey | AHGZJFPWMDGKFI-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 249.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.97 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|