C12H17ClFNO2 — CID 163331541
2-[(2-fluorophenyl)methylamino]-3-methylbutanoic acid;hydrochloride (PubChem CID 163331541) has the molecular formula C12H17ClFNO2 and a molecular weight of 261.72 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methylamino]-3-methylbutanoic acid;hydrochloride.
| Compound Name | 2-[(2-fluorophenyl)methylamino]-3-methylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 163331541 |
| Molecular Formula | C12H17ClFNO2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[(2-fluorophenyl)methylamino]-3-methylbutanoic acid;hydrochloride |
| SMILES | CC(C)C(NCc1ccccc1F)C(=O)O.Cl |
| InChI | InChI=1S/C12H16FNO2.ClH/c1-8(2)11(12(15)16)14-7-9-5-3-4-6-10(9)13;/h3-6,8,11,14H,7H2,1-2H3,(H,15,16);1H |
| InChIKey | OQGHCWUYXBSGNV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |