C44H52N2O12 — CID 163332159
bis(2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline);oxalic acid (PubChem CID 163332159) has the molecular formula C44H52N2O12 and a molecular weight of 800.90 g/mol. Its IUPAC name is bis(2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline);oxalic acid.
| Compound Name | bis(2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline);oxalic acid |
|---|---|
| PubChem CID | 163332159 |
| Molecular Formula | C44H52N2O12 |
| Molecular Weight | 800.90 g/mol |
| Exact Mass | 800.35 |
| IUPAC Name | bis(2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline);oxalic acid |
| SMILES | COc1cc2c(cc1OC)C(C)N(CC1COc3ccccc3O1)CC2.COc1cc2c(cc1OC)C(C)N(CC1COc3ccccc3O1)CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/2C21H25NO4.C2H2O4/c2*1-14-17-11-21(24-3)20(23-2)10-15(17)8-9-22(14)12-16-13-25-18-6-4-5-7-19(18)26-16;3-1(4)2(5)6/h2*4-7,10-11,14,16H,8-9,12-13H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | SVANKZXOJXETLI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|