C12H25ClN2O3 — CID 163332476
tert-butyl N-[[4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate;hydrochloride (PubChem CID 163332476) has the molecular formula C12H25ClN2O3 and a molecular weight of 280.80 g/mol. Its IUPAC name is tert-butyl N-[[4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[[4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 163332476 |
| Molecular Formula | C12H25ClN2O3 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | tert-butyl N-[[4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)NCC1(CO)CCNCC1.Cl |
| InChI | InChI=1S/C12H24N2O3.ClH/c1-11(2,3)17-10(16)14-8-12(9-15)4-6-13-7-5-12;/h13,15H,4-9H2,1-3H3,(H,14,16);1H |
| InChIKey | VMACSOWSANBGDT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |