C42H34Cl2N4O8 — CID 163332721
2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium diperchlorate (PubChem CID 163332721) has the molecular formula C42H34Cl2N4O8 and a molecular weight of 793.66 g/mol. Its IUPAC name is 2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium diperchlorate.
| Compound Name | 2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium diperchlorate |
|---|---|
| PubChem CID | 163332721 |
| Molecular Formula | C42H34Cl2N4O8 |
| Molecular Weight | 793.66 g/mol |
| Exact Mass | 792.18 |
| IUPAC Name | 2-[4-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-ium-2-ylidene)cyclohexa-2,5-dien-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium diperchlorate |
| SMILES | C1=CC(=[N+]2N=C(c3ccccc3)CC2c2ccccc2)C=CC1=C1C=CC(=[N+]2N=C(c3ccccc3)CC2c2ccccc2)C=C1.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C42H34N4.2ClHO4/c1-5-13-33(14-6-1)39-29-41(35-17-9-3-10-18-35)45(43-39)37-25-21-31(22-26-37)32-23-27-38(28-24-32)46-42(36-19-11-4-12-20-36)30-40(44-46)34-15-7-2-8-16-34;2*2-1(3,4)5/h1-28,41-42H,29-30H2;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | LQSCNIJSCYOJRL-UHFFFAOYSA-L |
| XLogP | -0.97 |
| TPSA | 215.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.66 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|