About (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate
(4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate (PubChem CID 163333059) has the molecular formula C5H9N7O2
and a molecular weight of 199.17 g/mol. Its IUPAC name is (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate.
Molecular Properties
| Compound Name | (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate |
| PubChem CID | 163333059 |
| Molecular Formula | C5H9N7O2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate |
| SMILES | COc1nnc(NN)c2n[nH]nc12.O |
| InChI | InChI=1S/C5H7N7O.H2O/c1-13-5-3-2(8-12-9-3)4(7-6)10-11-5;/h6H2,1H3,(H,7,10)(H,8,9,12);1H2 |
| InChIKey | SAYKIHGLYQYLPZ-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate?
The IUPAC name of (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate (CID 163333059) is (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate.
What is the SMILES notation for (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate?
The canonical SMILES for (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate is COc1nnc(NN)c2n[nH]nc12.O.
What is the InChIKey of (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate?
The InChIKey is SAYKIHGLYQYLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N7O.H2O/c1-13-5-3-2(8-12-9-3)4(7-6)10-11-5;/h6H2,1H3,(H,7,10)(H,8,9,12);1H2.
What are the key properties of (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate?
(4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate has a molecular weight of 199.17 g/mol, XLogP of -1.78, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2H-triazolo[4,5-d]pyridazin-7-yl)hydrazine;hydrate is sourced from PubChem (CID 163333059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).