C10H14N4O5S — CID 163333381
8-(5-amino-1,3,4-thiadiazol-2-yl)-1,3-dioxa-8-azaspiro[4.5]decan-2-one;formic acid (PubChem CID 163333381) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is 8-(5-amino-1,3,4-thiadiazol-2-yl)-1,3-dioxa-8-azaspiro[4.5]decan-2-one;formic acid.
| Compound Name | 8-(5-amino-1,3,4-thiadiazol-2-yl)-1,3-dioxa-8-azaspiro[4.5]decan-2-one;formic acid |
|---|---|
| PubChem CID | 163333381 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 8-(5-amino-1,3,4-thiadiazol-2-yl)-1,3-dioxa-8-azaspiro[4.5]decan-2-one;formic acid |
| SMILES | Nc1nnc(N2CCC3(CC2)COC(=O)O3)s1.O=CO |
| InChI | InChI=1S/C9H12N4O3S.CH2O2/c10-6-11-12-7(17-6)13-3-1-9(2-4-13)5-15-8(14)16-9;2-1-3/h1-5H2,(H2,10,11);1H,(H,2,3) |
| InChIKey | ROBADGRZRKBVNJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|