C21H26N2O5 — CID 163333459
(1R,2R,4S)-7-(2,3-dimethyl-1H-indole-5-carbonyl)-2-ethyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid (PubChem CID 163333459) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is (1R,2R,4S)-7-(2,3-dimethyl-1H-indole-5-carbonyl)-2-ethyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid.
| Compound Name | (1R,2R,4S)-7-(2,3-dimethyl-1H-indole-5-carbonyl)-2-ethyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 163333459 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (1R,2R,4S)-7-(2,3-dimethyl-1H-indole-5-carbonyl)-2-ethyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;formic acid |
| SMILES | CC[C@@]1(C(=O)O)C[C@@H]2CC[C@H]1N2C(=O)c1ccc2[nH]c(C)c(C)c2c1.O=CO |
| InChI | InChI=1S/C20H24N2O3.CH2O2/c1-4-20(19(24)25)10-14-6-8-17(20)22(14)18(23)13-5-7-16-15(9-13)11(2)12(3)21-16;2-1-3/h5,7,9,14,17,21H,4,6,8,10H2,1-3H3,(H,24,25);1H,(H,2,3)/t14-,17+,20+;/m0./s1 |
| InChIKey | CQCQYJGOMWBTFA-AWMKCAHASA-N |
| XLogP | 3.34 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|