C14H22N4O5S2 — CID 163333850
[(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-methyl-1,2,5-thiadiazol-3-yl)methanone;acetic acid (PubChem CID 163333850) has the molecular formula C14H22N4O5S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-methyl-1,2,5-thiadiazol-3-yl)methanone;acetic acid.
| Compound Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-methyl-1,2,5-thiadiazol-3-yl)methanone;acetic acid |
|---|---|
| PubChem CID | 163333850 |
| Molecular Formula | C14H22N4O5S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [(3S,3aS,6aR)-3-(dimethylamino)-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]-(4-methyl-1,2,5-thiadiazol-3-yl)methanone;acetic acid |
| SMILES | CC(=O)O.Cc1nsnc1C(=O)N1C[C@H]2[C@H](N(C)C)CS(=O)(=O)[C@H]2C1 |
| InChI | InChI=1S/C12H18N4O3S2.C2H4O2/c1-7-11(14-20-13-7)12(17)16-4-8-9(15(2)3)6-21(18,19)10(8)5-16;1-2(3)4/h8-10H,4-6H2,1-3H3;1H3,(H,3,4)/t8-,9+,10-;/m0./s1 |
| InChIKey | XCQWCDMETQNTTJ-JYNKJOSWSA-N |
| XLogP | -0.26 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |