About (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid
(2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid (PubChem CID 163333855) has the molecular formula C19H29FN2O4
and a molecular weight of 368.45 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid.
Molecular Properties
| Compound Name | (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid |
| PubChem CID | 163333855 |
| Molecular Formula | C19H29FN2O4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid |
| SMILES | CC(C)(C)[C@H]1C[C@@H](O)CC2(CCN(c3ccncc3F)CC2)O1.O=CO |
| InChI | InChI=1S/C18H27FN2O2.CH2O2/c1-17(2,3)16-10-13(22)11-18(23-16)5-8-21(9-6-18)15-4-7-20-12-14(15)19;2-1-3/h4,7,12-13,16,22H,5-6,8-11H2,1-3H3;1H,(H,2,3)/t13-,16-;/m1./s1 |
| InChIKey | QAACIAOOWGYMPJ-OALZAMAHSA-N |
| XLogP | 2.85 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid?
The IUPAC name of (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid (CID 163333855) is (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid.
What is the SMILES notation for (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid?
The canonical SMILES for (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid is CC(C)(C)[C@H]1C[C@@H](O)CC2(CCN(c3ccncc3F)CC2)O1.O=CO.
What is the InChIKey of (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid?
The InChIKey is QAACIAOOWGYMPJ-OALZAMAHSA-N. The full InChI is InChI=1S/C18H27FN2O2.CH2O2/c1-17(2,3)16-10-13(22)11-18(23-16)5-8-21(9-6-18)15-4-7-20-12-14(15)19;2-1-3/h4,7,12-13,16,22H,5-6,8-11H2,1-3H3;1H,(H,2,3)/t13-,16-;/m1./s1.
What are the key properties of (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid?
(2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid has a molecular weight of 368.45 g/mol, XLogP of 2.85, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-tert-butyl-9-(3-fluoro-4-pyridinyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol;formic acid is sourced from PubChem (CID 163333855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).