C21H32N4O4S — CID 163334085
(3S,3aS,6aR)-N,N-dimethyl-5-[[1-(2-methylpropyl)benzimidazol-2-yl]methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;formic acid (PubChem CID 163334085) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is (3S,3aS,6aR)-N,N-dimethyl-5-[[1-(2-methylpropyl)benzimidazol-2-yl]methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;formic acid.
| Compound Name | (3S,3aS,6aR)-N,N-dimethyl-5-[[1-(2-methylpropyl)benzimidazol-2-yl]methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;formic acid |
|---|---|
| PubChem CID | 163334085 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (3S,3aS,6aR)-N,N-dimethyl-5-[[1-(2-methylpropyl)benzimidazol-2-yl]methyl]-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine;formic acid |
| SMILES | CC(C)Cn1c(CN2C[C@H]3[C@H](N(C)C)CS(=O)(=O)[C@H]3C2)nc2ccccc21.O=CO |
| InChI | InChI=1S/C20H30N4O2S.CH2O2/c1-14(2)9-24-17-8-6-5-7-16(17)21-20(24)12-23-10-15-18(22(3)4)13-27(25,26)19(15)11-23;2-1-3/h5-8,14-15,18-19H,9-13H2,1-4H3;1H,(H,2,3)/t15-,18+,19-;/m0./s1 |
| InChIKey | VLWYOIWDECWGMC-RPSFMSQRSA-N |
| XLogP | 1.55 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|