C20H27N3O8 — CID 163334191
(6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-2-(6-methyl-4-oxopyran-2-carbonyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid (PubChem CID 163334191) has the molecular formula C20H27N3O8 and a molecular weight of 437.45 g/mol. Its IUPAC name is (6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-2-(6-methyl-4-oxopyran-2-carbonyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid.
| Compound Name | (6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-2-(6-methyl-4-oxopyran-2-carbonyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid |
|---|---|
| PubChem CID | 163334191 |
| Molecular Formula | C20H27N3O8 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (6S,7S,8aS)-6-ethyl-N-(2-hydroxyethyl)-2-(6-methyl-4-oxopyran-2-carbonyl)-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid |
| SMILES | CC[C@H]1[C@@H](C(=O)NCCO)C[C@H]2CN(C(=O)c3cc(=O)cc(C)o3)CC(=O)N21.O=CO |
| InChI | InChI=1S/C19H25N3O6.CH2O2/c1-3-15-14(18(26)20-4-5-23)7-12-9-21(10-17(25)22(12)15)19(27)16-8-13(24)6-11(2)28-16;2-1-3/h6,8,12,14-15,23H,3-5,7,9-10H2,1-2H3,(H,20,26);1H,(H,2,3)/t12-,14-,15-;/m0./s1 |
| InChIKey | LEMJLBZCXDWYGG-XJPBFQKESA-N |
| XLogP | -0.79 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|