C17H27N3O4 — CID 163334244
ethyl 4-(3-cyclopropyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)butanoate;formic acid (PubChem CID 163334244) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl 4-(3-cyclopropyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)butanoate;formic acid.
| Compound Name | ethyl 4-(3-cyclopropyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)butanoate;formic acid |
|---|---|
| PubChem CID | 163334244 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | ethyl 4-(3-cyclopropyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)butanoate;formic acid |
| SMILES | CCOC(=O)CCCN1CCc2[nH]nc(C3CC3)c2CC1.O=CO |
| InChI | InChI=1S/C16H25N3O2.CH2O2/c1-2-21-15(20)4-3-9-19-10-7-13-14(8-11-19)17-18-16(13)12-5-6-12;2-1-3/h12H,2-11H2,1H3,(H,17,18);1H,(H,2,3) |
| InChIKey | SFLYCNMXNBSLKH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|