C24H28N4O6 — CID 163334431
acetic acid;1-ethyl-4-[[2-[5-(4-methoxyphenyl)furan-2-yl]imidazol-1-yl]methyl]imidazole (PubChem CID 163334431) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is acetic acid;1-ethyl-4-[[2-[5-(4-methoxyphenyl)furan-2-yl]imidazol-1-yl]methyl]imidazole.
| Compound Name | acetic acid;1-ethyl-4-[[2-[5-(4-methoxyphenyl)furan-2-yl]imidazol-1-yl]methyl]imidazole |
|---|---|
| PubChem CID | 163334431 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | acetic acid;1-ethyl-4-[[2-[5-(4-methoxyphenyl)furan-2-yl]imidazol-1-yl]methyl]imidazole |
| SMILES | CC(=O)O.CC(=O)O.CCn1cnc(Cn2ccnc2-c2ccc(-c3ccc(OC)cc3)o2)c1 |
| InChI | InChI=1S/C20H20N4O2.2C2H4O2/c1-3-23-12-16(22-14-23)13-24-11-10-21-20(24)19-9-8-18(26-19)15-4-6-17(25-2)7-5-15;2*1-2(3)4/h4-12,14H,3,13H2,1-2H3;2*1H3,(H,3,4) |
| InChIKey | NIRJRVANRIJCFI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |