C18H26Cl2N4O — CID 163334483
(4S,9aR)-8-[(5-methyl-1H-imidazol-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;dihydrochloride (PubChem CID 163334483) has the molecular formula C18H26Cl2N4O and a molecular weight of 385.34 g/mol. Its IUPAC name is (4S,9aR)-8-[(5-methyl-1H-imidazol-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;dihydrochloride.
| Compound Name | (4S,9aR)-8-[(5-methyl-1H-imidazol-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;dihydrochloride |
|---|---|
| PubChem CID | 163334483 |
| Molecular Formula | C18H26Cl2N4O |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (4S,9aR)-8-[(5-methyl-1H-imidazol-2-yl)methyl]-4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine;dihydrochloride |
| SMILES | Cc1cnc(CN2CCN3[C@@H](COC[C@@H]3c3ccccc3)C2)[nH]1.Cl.Cl |
| InChI | InChI=1S/C18H24N4O.2ClH/c1-14-9-19-18(20-14)11-21-7-8-22-16(10-21)12-23-13-17(22)15-5-3-2-4-6-15;;/h2-6,9,16-17H,7-8,10-13H2,1H3,(H,19,20);2*1H/t16-,17-;;/m1../s1 |
| InChIKey | YFWLGJOJISFUSB-QAPNYFPESA-N |
| XLogP | 2.82 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |