C16H28Cl2N6O — CID 163334523
(1-methyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone;dihydrochloride (PubChem CID 163334523) has the molecular formula C16H28Cl2N6O and a molecular weight of 391.35 g/mol. Its IUPAC name is (1-methyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone;dihydrochloride.
| Compound Name | (1-methyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 163334523 |
| Molecular Formula | C16H28Cl2N6O |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (1-methyl-1,4,9-triazaspiro[5.5]undecan-4-yl)-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)methanone;dihydrochloride |
| SMILES | CN1CCN(C(=O)C2CCc3ncnn3C2)CC12CCNCC2.Cl.Cl |
| InChI | InChI=1S/C16H26N6O.2ClH/c1-20-8-9-21(11-16(20)4-6-17-7-5-16)15(23)13-2-3-14-18-12-19-22(14)10-13;;/h12-13,17H,2-11H2,1H3;2*1H |
| InChIKey | XYHAWTSESAGIKN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |