C19H27N3O6S — CID 163334791
formic acid;4-[2-[2-(4-methoxy-2,5-dimethylphenyl)imidazol-1-yl]ethylsulfonyl]morpholine (PubChem CID 163334791) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is formic acid;4-[2-[2-(4-methoxy-2,5-dimethylphenyl)imidazol-1-yl]ethylsulfonyl]morpholine.
| Compound Name | formic acid;4-[2-[2-(4-methoxy-2,5-dimethylphenyl)imidazol-1-yl]ethylsulfonyl]morpholine |
|---|---|
| PubChem CID | 163334791 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | formic acid;4-[2-[2-(4-methoxy-2,5-dimethylphenyl)imidazol-1-yl]ethylsulfonyl]morpholine |
| SMILES | COc1cc(C)c(-c2nccn2CCS(=O)(=O)N2CCOCC2)cc1C.O=CO |
| InChI | InChI=1S/C18H25N3O4S.CH2O2/c1-14-13-17(24-3)15(2)12-16(14)18-19-4-5-20(18)8-11-26(22,23)21-6-9-25-10-7-21;2-1-3/h4-5,12-13H,6-11H2,1-3H3;1H,(H,2,3) |
| InChIKey | HSNKRZCPZARTJA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|