C24H32N4O6 — CID 163335189
formic acid;17-methoxy-8-[2-(6-methyl-2-pyridinyl)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione (PubChem CID 163335189) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is formic acid;17-methoxy-8-[2-(6-methyl-2-pyridinyl)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione.
| Compound Name | formic acid;17-methoxy-8-[2-(6-methyl-2-pyridinyl)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
|---|---|
| PubChem CID | 163335189 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | formic acid;17-methoxy-8-[2-(6-methyl-2-pyridinyl)ethyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
| SMILES | COc1ccc2c(c1)OCCNC(=O)CN(CCc1cccc(C)n1)CCCNC2=O.O=CO |
| InChI | InChI=1S/C23H30N4O4.CH2O2/c1-17-5-3-6-18(26-17)9-13-27-12-4-10-25-23(29)20-8-7-19(30-2)15-21(20)31-14-11-24-22(28)16-27;2-1-3/h3,5-8,15H,4,9-14,16H2,1-2H3,(H,24,28)(H,25,29);1H,(H,2,3) |
| InChIKey | QXHGIXAYJAVLRA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|