C13H18N2O2 — CID 163335484
(3S,3aR,7aS)-3-(pyridin-2-ylmethoxy)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole (PubChem CID 163335484) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-(pyridin-2-ylmethoxy)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole.
| Compound Name | (3S,3aR,7aS)-3-(pyridin-2-ylmethoxy)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 163335484 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (3S,3aR,7aS)-3-(pyridin-2-ylmethoxy)-1,2,3,3a,5,6,7,7a-octahydropyrano[3,2-b]pyrrole |
| SMILES | c1ccc(CO[C@H]2CN[C@H]3CCCO[C@H]32)nc1 |
| InChI | InChI=1S/C13H18N2O2/c1-2-6-14-10(4-1)9-17-12-8-15-11-5-3-7-16-13(11)12/h1-2,4,6,11-13,15H,3,5,7-9H2/t11-,12-,13+/m0/s1 |
| InChIKey | ASXRPNQGTLOTTJ-RWMBFGLXSA-N |
| XLogP | 1.12 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |