C17H19FN4O — CID 163336101
2-(2-fluorophenyl)-1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone (PubChem CID 163336101) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone.
| Compound Name | 2-(2-fluorophenyl)-1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone |
|---|---|
| PubChem CID | 163336101 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-(2-fluorophenyl)-1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone |
| SMILES | Cc1nnc2n1C[C@H]1CC[C@@H](C2)N1C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C17H19FN4O/c1-11-19-20-16-9-13-6-7-14(10-21(11)16)22(13)17(23)8-12-4-2-3-5-15(12)18/h2-5,13-14H,6-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | GZFMOJZABKOCPE-UONOGXRCSA-N |
| XLogP | 1.88 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |