C8H12N4O3 — CID 163336271
1-ethyl-N,N-dimethyl-4-nitropyrazole-3-carboxamide (PubChem CID 163336271) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N,N-dimethyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163336271 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-4-nitropyrazole-3-carboxamide |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)N(C)C)n1 |
| InChI | InChI=1S/C8H12N4O3/c1-4-11-5-6(12(14)15)7(9-11)8(13)10(2)3/h5H,4H2,1-3H3 |
| InChIKey | PTFDUPLFYSXNGO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|