C25H28N4O2S — CID 163337470
N-butyl-3-[5-[(4-methylphenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide (PubChem CID 163337470) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-butyl-3-[5-[(4-methylphenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide.
| Compound Name | N-butyl-3-[5-[(4-methylphenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide |
|---|---|
| PubChem CID | 163337470 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-butyl-3-[5-[(4-methylphenyl)methylsulfanyl]-2-oxo-3H-imidazo[1,2-c]quinazolin-3-yl]propanamide |
| SMILES | CCCCNC(=O)CCC1C(=O)N=C2c3ccccc3N=C(SCc3ccc(C)cc3)N21 |
| InChI | InChI=1S/C25H28N4O2S/c1-3-4-15-26-22(30)14-13-21-24(31)28-23-19-7-5-6-8-20(19)27-25(29(21)23)32-16-18-11-9-17(2)10-12-18/h5-12,21H,3-4,13-16H2,1-2H3,(H,26,30) |
| InChIKey | ZNOAXWNPGKZSGD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|