C16H21N3O5S — CID 163338081
N-[5-[1-(4-ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide;formic acid (PubChem CID 163338081) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[5-[1-(4-ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide;formic acid.
| Compound Name | N-[5-[1-(4-ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide;formic acid |
|---|---|
| PubChem CID | 163338081 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[5-[1-(4-ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-2-methoxyacetamide;formic acid |
| SMILES | CCc1ccc(OC(C)c2nnc(NC(=O)COC)s2)cc1.O=CO |
| InChI | InChI=1S/C15H19N3O3S.CH2O2/c1-4-11-5-7-12(8-6-11)21-10(2)14-17-18-15(22-14)16-13(19)9-20-3;2-1-3/h5-8,10H,4,9H2,1-3H3,(H,16,18,19);1H,(H,2,3) |
| InChIKey | CWJWJANLEHMLHF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|