C20H23ClN2O4 — CID 163338667
2-(3-chlorophenoxy)-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one (PubChem CID 163338667) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one.
| Compound Name | 2-(3-chlorophenoxy)-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one |
|---|---|
| PubChem CID | 163338667 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-[2-(2-methoxyethoxy)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]propan-1-one |
| SMILES | COCCOc1ccc2c(n1)CCN(C(=O)C(C)Oc1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C20H23ClN2O4/c1-14(27-17-5-3-4-16(21)12-17)20(24)23-9-8-18-15(13-23)6-7-19(22-18)26-11-10-25-2/h3-7,12,14H,8-11,13H2,1-2H3 |
| InChIKey | OQBVYISKWIJVRB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|