C19H34O8 — CID 163339296
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(2-hydroxy-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-1-yl)butan-2-yloxy]oxane-3,4,5-triol (PubChem CID 163339296) has the molecular formula C19H34O8 and a molecular weight of 390.47 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(2-hydroxy-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-1-yl)butan-2-yloxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(2-hydroxy-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-1-yl)butan-2-yloxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163339296 |
| Molecular Formula | C19H34O8 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(2-hydroxy-2,6,6-trimethyl-7-oxabicyclo[2.2.1]heptan-1-yl)butan-2-yloxy]oxane-3,4,5-triol |
| SMILES | CC(CCC12OC(CC1(C)C)CC2(C)O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H34O8/c1-10(25-16-15(23)14(22)13(21)12(9-20)26-16)5-6-19-17(2,3)7-11(27-19)8-18(19,4)24/h10-16,20-24H,5-9H2,1-4H3/t10?,11?,12-,13-,14+,15-,16-,18?,19?/m1/s1 |
| InChIKey | MQENNBZSORVHQZ-DVQIAHNFSA-N |
| XLogP | -0.32 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |