C20H25N3O4S — CID 163340575
N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-oxopiperidin-1-yl)acetamide;formic acid (PubChem CID 163340575) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-oxopiperidin-1-yl)acetamide;formic acid.
| Compound Name | N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-oxopiperidin-1-yl)acetamide;formic acid |
|---|---|
| PubChem CID | 163340575 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-oxopiperidin-1-yl)acetamide;formic acid |
| SMILES | Cc1ccc(C)c(-c2nc(NC(=O)CN3CCCCC3=O)sc2C)c1.O=CO |
| InChI | InChI=1S/C19H23N3O2S.CH2O2/c1-12-7-8-13(2)15(10-12)18-14(3)25-19(21-18)20-16(23)11-22-9-5-4-6-17(22)24;2-1-3/h7-8,10H,4-6,9,11H2,1-3H3,(H,20,21,23);1H,(H,2,3) |
| InChIKey | NODHYZQIJXQOAU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|