C17H22N6O5 — CID 163340611
formic acid;(2S,3R)-4-methyl-3-(2-methylphenyl)-5-oxo-N-[2-(2H-tetrazol-5-yl)ethyl]morpholine-2-carboxamide (PubChem CID 163340611) has the molecular formula C17H22N6O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is formic acid;(2S,3R)-4-methyl-3-(2-methylphenyl)-5-oxo-N-[2-(2H-tetrazol-5-yl)ethyl]morpholine-2-carboxamide.
| Compound Name | formic acid;(2S,3R)-4-methyl-3-(2-methylphenyl)-5-oxo-N-[2-(2H-tetrazol-5-yl)ethyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 163340611 |
| Molecular Formula | C17H22N6O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | formic acid;(2S,3R)-4-methyl-3-(2-methylphenyl)-5-oxo-N-[2-(2H-tetrazol-5-yl)ethyl]morpholine-2-carboxamide |
| SMILES | Cc1ccccc1[C@@H]1[C@@H](C(=O)NCCc2nn[nH]n2)OCC(=O)N1C.O=CO |
| InChI | InChI=1S/C16H20N6O3.CH2O2/c1-10-5-3-4-6-11(10)14-15(25-9-13(23)22(14)2)16(24)17-8-7-12-18-20-21-19-12;2-1-3/h3-6,14-15H,7-9H2,1-2H3,(H,17,24)(H,18,19,20,21);1H,(H,2,3)/t14-,15+;/m1./s1 |
| InChIKey | SCKXJPJDSTXHEF-LIOBNPLQSA-N |
| XLogP | -0.53 |
| TPSA | 150.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|