C19H25FN2O7 — CID 163340988
formic acid;methyl 3-[[(1S,3R,4R)-3-[(2-fluoro-4-methylbenzoyl)amino]-4-hydroxycyclopentanecarbonyl]amino]propanoate (PubChem CID 163340988) has the molecular formula C19H25FN2O7 and a molecular weight of 412.41 g/mol. Its IUPAC name is formic acid;methyl 3-[[(1S,3R,4R)-3-[(2-fluoro-4-methylbenzoyl)amino]-4-hydroxycyclopentanecarbonyl]amino]propanoate.
| Compound Name | formic acid;methyl 3-[[(1S,3R,4R)-3-[(2-fluoro-4-methylbenzoyl)amino]-4-hydroxycyclopentanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 163340988 |
| Molecular Formula | C19H25FN2O7 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | formic acid;methyl 3-[[(1S,3R,4R)-3-[(2-fluoro-4-methylbenzoyl)amino]-4-hydroxycyclopentanecarbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@@H]1C[C@@H](O)[C@H](NC(=O)c2ccc(C)cc2F)C1.O=CO |
| InChI | InChI=1S/C18H23FN2O5.CH2O2/c1-10-3-4-12(13(19)7-10)18(25)21-14-8-11(9-15(14)22)17(24)20-6-5-16(23)26-2;2-1-3/h3-4,7,11,14-15,22H,5-6,8-9H2,1-2H3,(H,20,24)(H,21,25);1H,(H,2,3)/t11-,14+,15+;/m0./s1 |
| InChIKey | ZGGXWENTZVOTEV-ZOOLKIEGSA-N |
| XLogP | 0.38 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|