C14H22N8O4 — CID 163341139
formic acid;3-[3-oxo-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 163341139) has the molecular formula C14H22N8O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is formic acid;3-[3-oxo-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | formic acid;3-[3-oxo-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 163341139 |
| Molecular Formula | C14H22N8O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | formic acid;3-[3-oxo-3-[4-[2-(1,2,4-triazol-1-yl)ethyl]piperazin-1-yl]propyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=C(CCc1n[nH]c(=O)[nH]1)N1CCN(CCn2cncn2)CC1.O=CO |
| InChI | InChI=1S/C13H20N8O2.CH2O2/c22-12(2-1-11-16-13(23)18-17-11)20-6-3-19(4-7-20)5-8-21-10-14-9-15-21;2-1-3/h9-10H,1-8H2,(H2,16,17,18,23);1H,(H,2,3) |
| InChIKey | MHBSFXHTLATQNO-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|