C17H12F3N7O3 — CID 163341523
formic acid;6-(1,2,4-triazol-4-yl)-N-[6-(trifluoromethyl)-1H-indazol-3-yl]pyridine-2-carboxamide (PubChem CID 163341523) has the molecular formula C17H12F3N7O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is formic acid;6-(1,2,4-triazol-4-yl)-N-[6-(trifluoromethyl)-1H-indazol-3-yl]pyridine-2-carboxamide.
| Compound Name | formic acid;6-(1,2,4-triazol-4-yl)-N-[6-(trifluoromethyl)-1H-indazol-3-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163341523 |
| Molecular Formula | C17H12F3N7O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | formic acid;6-(1,2,4-triazol-4-yl)-N-[6-(trifluoromethyl)-1H-indazol-3-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1n[nH]c2cc(C(F)(F)F)ccc12)c1cccc(-n2cnnc2)n1.O=CO |
| InChI | InChI=1S/C16H10F3N7O.CH2O2/c17-16(18,19)9-4-5-10-12(6-9)24-25-14(10)23-15(27)11-2-1-3-13(22-11)26-7-20-21-8-26;2-1-3/h1-8H,(H2,23,24,25,27);1H,(H,2,3) |
| InChIKey | QKYYTWGFUOAFJH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|