C23H32N2O7 — CID 163341583
(2S,3R)-4-cyclopropyl-N-[(1-hydroxycyclohexyl)methyl]-3-(4-methoxyphenyl)-5-oxomorpholine-2-carboxamide;formic acid (PubChem CID 163341583) has the molecular formula C23H32N2O7 and a molecular weight of 448.52 g/mol. Its IUPAC name is (2S,3R)-4-cyclopropyl-N-[(1-hydroxycyclohexyl)methyl]-3-(4-methoxyphenyl)-5-oxomorpholine-2-carboxamide;formic acid.
| Compound Name | (2S,3R)-4-cyclopropyl-N-[(1-hydroxycyclohexyl)methyl]-3-(4-methoxyphenyl)-5-oxomorpholine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 163341583 |
| Molecular Formula | C23H32N2O7 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (2S,3R)-4-cyclopropyl-N-[(1-hydroxycyclohexyl)methyl]-3-(4-methoxyphenyl)-5-oxomorpholine-2-carboxamide;formic acid |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)NCC3(O)CCCCC3)OCC(=O)N2C2CC2)cc1.O=CO |
| InChI | InChI=1S/C22H30N2O5.CH2O2/c1-28-17-9-5-15(6-10-17)19-20(29-13-18(25)24(19)16-7-8-16)21(26)23-14-22(27)11-3-2-4-12-22;2-1-3/h5-6,9-10,16,19-20,27H,2-4,7-8,11-14H2,1H3,(H,23,26);1H,(H,2,3)/t19-,20+;/m1./s1 |
| InChIKey | ALXRZFVVWDGILN-FDOHDBATSA-N |
| XLogP | 1.64 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|