C20H35N5O5 — CID 163341720
formic acid;(1S,3R,4R)-3-(oxan-4-ylamino)-4-propoxy-N-[2-(triazol-1-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 163341720) has the molecular formula C20H35N5O5 and a molecular weight of 425.53 g/mol. Its IUPAC name is formic acid;(1S,3R,4R)-3-(oxan-4-ylamino)-4-propoxy-N-[2-(triazol-1-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | formic acid;(1S,3R,4R)-3-(oxan-4-ylamino)-4-propoxy-N-[2-(triazol-1-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 163341720 |
| Molecular Formula | C20H35N5O5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | formic acid;(1S,3R,4R)-3-(oxan-4-ylamino)-4-propoxy-N-[2-(triazol-1-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | CCCO[C@@H]1CC[C@H](C(=O)NCCn2ccnn2)C[C@H]1NC1CCOCC1.O=CO |
| InChI | InChI=1S/C19H33N5O3.CH2O2/c1-2-11-27-18-4-3-15(14-17(18)22-16-5-12-26-13-6-16)19(25)20-7-9-24-10-8-21-23-24;2-1-3/h8,10,15-18,22H,2-7,9,11-14H2,1H3,(H,20,25);1H,(H,2,3)/t15-,17+,18+;/m0./s1 |
| InChIKey | BZEGVZHTFFTBER-FLCXFYETSA-N |
| XLogP | 0.83 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|